C13H10F3N3O — CID 104641160
5-(methylamino)-N-(2,4,5-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 104641160) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 5-(methylamino)-N-(2,4,5-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-(methylamino)-N-(2,4,5-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104641160 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-(methylamino)-N-(2,4,5-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2cc(F)c(F)cc2F)nc1 |
| InChI | InChI=1S/C13H10F3N3O/c1-17-7-2-3-11(18-6-7)13(20)19-12-5-9(15)8(14)4-10(12)16/h2-6,17H,1H3,(H,19,20) |
| InChIKey | GWHKXNIGYLPRHZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|