C14H12F3N3O — CID 104641163
5-(ethylamino)-N-(2,3,5-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 104641163) has the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. Its IUPAC name is 5-(ethylamino)-N-(2,3,5-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-(2,3,5-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104641163 |
| Molecular Formula | C14H12F3N3O |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-(ethylamino)-N-(2,3,5-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | CCNc1ccc(C(=O)Nc2cc(F)cc(F)c2F)nc1 |
| InChI | InChI=1S/C14H12F3N3O/c1-2-18-9-3-4-11(19-7-9)14(21)20-12-6-8(15)5-10(16)13(12)17/h3-7,18H,2H2,1H3,(H,20,21) |
| InChIKey | SVWGWQVRPIQUBS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|