C27H31F3N3OPS — CID 145232280
N-[3,5-difluoro-4-(2-methylbut-3-en-2-yl)phenyl]-2-(5-ethylsulfanyl-2-pyridinyl)acetamide;5-fluoro-N-methyl-2-phosphanylaniline (PubChem CID 145232280) has the molecular formula C27H31F3N3OPS and a molecular weight of 533.60 g/mol. Its IUPAC name is N-[3,5-difluoro-4-(2-methylbut-3-en-2-yl)phenyl]-2-(5-ethylsulfanyl-2-pyridinyl)acetamide;5-fluoro-N-methyl-2-phosphanylaniline.
| Compound Name | N-[3,5-difluoro-4-(2-methylbut-3-en-2-yl)phenyl]-2-(5-ethylsulfanyl-2-pyridinyl)acetamide;5-fluoro-N-methyl-2-phosphanylaniline |
|---|---|
| PubChem CID | 145232280 |
| Molecular Formula | C27H31F3N3OPS |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | N-[3,5-difluoro-4-(2-methylbut-3-en-2-yl)phenyl]-2-(5-ethylsulfanyl-2-pyridinyl)acetamide;5-fluoro-N-methyl-2-phosphanylaniline |
| SMILES | C=CC(C)(C)c1c(F)cc(NC(=O)Cc2ccc(SCC)cn2)cc1F.CNc1cc(F)ccc1P |
| InChI | InChI=1S/C20H22F2N2OS.C7H9FNP/c1-5-20(3,4)19-16(21)9-14(10-17(19)22)24-18(25)11-13-7-8-15(12-23-13)26-6-2;1-9-6-4-5(8)2-3-7(6)10/h5,7-10,12H,1,6,11H2,2-4H3,(H,24,25);2-4,9H,10H2,1H3 |
| InChIKey | HKQRGVLJVZQPPG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|