C16H9Cl2F3N2O4 — CID 92508875
(2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(4-nitrophenyl)-3-oxopropanamide (PubChem CID 92508875) has the molecular formula C16H9Cl2F3N2O4 and a molecular weight of 421.16 g/mol. Its IUPAC name is (2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(4-nitrophenyl)-3-oxopropanamide.
| Compound Name | (2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(4-nitrophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 92508875 |
| Molecular Formula | C16H9Cl2F3N2O4 |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | (2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-3-(4-nitrophenyl)-3-oxopropanamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)[C@H](Cl)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H9Cl2F3N2O4/c17-11-6-3-9(16(19,20)21)7-12(11)22-15(25)13(18)14(24)8-1-4-10(5-2-8)23(26)27/h1-7,13H,(H,22,25)/t13-/m1/s1 |
| InChIKey | MGOUMLSLCUGQNN-CYBMUJFWSA-N |
| XLogP | 4.70 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|