C26H24N6O4 — CID 136509951
N-[N'-[[amino-[[5-(2-methylphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methylphenyl)furan-2-carboxamide (PubChem CID 136509951) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is N-[N'-[[amino-[[5-(2-methylphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methylphenyl)furan-2-carboxamide.
| Compound Name | N-[N'-[[amino-[[5-(2-methylphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 136509951 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[N'-[[amino-[[5-(2-methylphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1cccc(-c2ccc(C(=O)NC(N)=NN=C(N)NC(=O)c3ccc(-c4ccccc4C)o3)o2)c1 |
| InChI | InChI=1S/C26H24N6O4/c1-15-6-5-8-17(14-15)19-10-12-21(35-19)23(33)29-25(27)31-32-26(28)30-24(34)22-13-11-20(36-22)18-9-4-3-7-16(18)2/h3-14H,1-2H3,(H3,27,29,31,33)(H3,28,30,32,34) |
| InChIKey | OCQYEWFLORCABY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 161.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|