C19H16BrN3O2S — CID 17047093
N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-5-(3-methylphenyl)furan-2-carboxamide (PubChem CID 17047093) has the molecular formula C19H16BrN3O2S and a molecular weight of 430.33 g/mol. Its IUPAC name is N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-5-(3-methylphenyl)furan-2-carboxamide.
| Compound Name | N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-5-(3-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17047093 |
| Molecular Formula | C19H16BrN3O2S |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-5-(3-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1cccc(-c2ccc(C(=O)NC(=S)Nc3ccc(Br)c(C)n3)o2)c1 |
| InChI | InChI=1S/C19H16BrN3O2S/c1-11-4-3-5-13(10-11)15-7-8-16(25-15)18(24)23-19(26)22-17-9-6-14(20)12(2)21-17/h3-10H,1-2H3,(H2,21,22,23,24,26) |
| InChIKey | XPZWZNZKOJHNLE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|