C17H23N5O4 — CID 69098326
(2S)-2-[[5-(2-aminophenyl)furan-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid (PubChem CID 69098326) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2S)-2-[[5-(2-aminophenyl)furan-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid.
| Compound Name | (2S)-2-[[5-(2-aminophenyl)furan-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid |
|---|---|
| PubChem CID | 69098326 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2S)-2-[[5-(2-aminophenyl)furan-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid |
| SMILES | Nc1ccccc1-c1ccc(C(=O)N[C@@H](CCCNC(N)N)C(=O)O)o1 |
| InChI | InChI=1S/C17H23N5O4/c18-11-5-2-1-4-10(11)13-7-8-14(26-13)15(23)22-12(16(24)25)6-3-9-21-17(19)20/h1-2,4-5,7-8,12,17,21H,3,6,9,18-20H2,(H,22,23)(H,24,25)/t12-/m0/s1 |
| InChIKey | RTSCVRLYGVKKJZ-LBPRGKRZSA-N |
| XLogP | 0.28 |
| TPSA | 169.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|