C24H41N7O5 — CID 118551231
2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 118551231) has the molecular formula C24H41N7O5 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 118551231 |
| Molecular Formula | C24H41N7O5 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(CCCNC(N)N)NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C24H41N7O5/c1-14(2)12-19(23(35)36)31-22(34)18(13-16-8-5-4-6-9-16)30-21(33)17(29-20(32)15(3)25)10-7-11-28-24(26)27/h4-6,8-9,14-15,17-19,24,28H,7,10-13,25-27H2,1-3H3,(H,29,32)(H,30,33)(H,31,34)(H,35,36) |
| InChIKey | NXGWSXPHBGLLHD-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 214.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|