C18H26N6O5S2 — CID 69098308
(2S)-2-[[3-[[3-(aminomethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid (PubChem CID 69098308) has the molecular formula C18H26N6O5S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is (2S)-2-[[3-[[3-(aminomethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid.
| Compound Name | (2S)-2-[[3-[[3-(aminomethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid |
|---|---|
| PubChem CID | 69098308 |
| Molecular Formula | C18H26N6O5S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (2S)-2-[[3-[[3-(aminomethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid |
| SMILES | NCc1cccc(S(=O)(=O)Nc2ccsc2C(=O)N[C@@H](CCCNC(N)N)C(=O)O)c1 |
| InChI | InChI=1S/C18H26N6O5S2/c19-10-11-3-1-4-12(9-11)31(28,29)24-13-6-8-30-15(13)16(25)23-14(17(26)27)5-2-7-22-18(20)21/h1,3-4,6,8-9,14,18,22,24H,2,5,7,10,19-21H2,(H,23,25)(H,26,27)/t14-/m0/s1 |
| InChIKey | RHQGYGWYVIYTGV-AWEZNQCLSA-N |
| XLogP | -0.24 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|