C19H21N5O5S3 — CID 59159544
(2S)-2-[[3-(1-benzothiophen-2-ylsulfonylamino)thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 59159544) has the molecular formula C19H21N5O5S3 and a molecular weight of 495.61 g/mol. Its IUPAC name is (2S)-2-[[3-(1-benzothiophen-2-ylsulfonylamino)thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[3-(1-benzothiophen-2-ylsulfonylamino)thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 59159544 |
| Molecular Formula | C19H21N5O5S3 |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | (2S)-2-[[3-(1-benzothiophen-2-ylsulfonylamino)thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C19H21N5O5S3/c20-19(21)22-8-3-5-13(18(26)27)23-17(25)16-12(7-9-30-16)24-32(28,29)15-10-11-4-1-2-6-14(11)31-15/h1-2,4,6-7,9-10,13,24H,3,5,8H2,(H,23,25)(H,26,27)(H4,20,21,22)/t13-/m0/s1 |
| InChIKey | JNGYRNNUBUZZMR-ZDUSSCGKSA-N |
| XLogP | 2.00 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|