C16H23N7O5S2 — CID 134146935
(2S)-5-(diaminomethylideneamino)-2-[[3-[(2,5-dimethyl-1H-imidazol-4-yl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 134146935) has the molecular formula C16H23N7O5S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[(2,5-dimethyl-1H-imidazol-4-yl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[(2,5-dimethyl-1H-imidazol-4-yl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 134146935 |
| Molecular Formula | C16H23N7O5S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[(2,5-dimethyl-1H-imidazol-4-yl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | Cc1nc(S(=O)(=O)Nc2ccsc2C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)c(C)[nH]1 |
| InChI | InChI=1S/C16H23N7O5S2/c1-8-14(21-9(2)20-8)30(27,28)23-10-5-7-29-12(10)13(24)22-11(15(25)26)4-3-6-19-16(17)18/h5,7,11,23H,3-4,6H2,1-2H3,(H,20,21)(H,22,24)(H,25,26)(H4,17,18,19)/t11-/m0/s1 |
| InChIKey | HZNCOWSZUCBNKD-NSHDSACASA-N |
| XLogP | 0.13 |
| TPSA | 205.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|