C23H30N8O5S2 — CID 59159612
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2,5-dimethylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 59159612) has the molecular formula C23H30N8O5S2 and a molecular weight of 562.68 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2,5-dimethylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2,5-dimethylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59159612 |
| Molecular Formula | C23H30N8O5S2 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2,5-dimethylpyrazol-3-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | Cc1cc(CNc2cccc(S(=O)(=O)Nc3ccsc3C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)c2)n(C)n1 |
| InChI | InChI=1S/C23H30N8O5S2/c1-14-11-16(31(2)29-14)13-27-15-5-3-6-17(12-15)38(35,36)30-18-8-10-37-20(18)21(32)28-19(22(33)34)7-4-9-26-23(24)25/h3,5-6,8,10-12,19,27,30H,4,7,9,13H2,1-2H3,(H,28,32)(H,33,34)(H4,24,25,26)/t19-/m0/s1 |
| InChIKey | FVADIWDDVDCHMM-IBGZPJMESA-N |
| XLogP | 1.44 |
| TPSA | 206.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|