C25H34N8O6S2 — CID 69098286
(2S)-5-(diaminomethylamino)-2-[[3-[[3-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoyl]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 69098286) has the molecular formula C25H34N8O6S2 and a molecular weight of 606.73 g/mol. Its IUPAC name is (2S)-5-(diaminomethylamino)-2-[[3-[[3-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoyl]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylamino)-2-[[3-[[3-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoyl]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69098286 |
| Molecular Formula | C25H34N8O6S2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | (2S)-5-(diaminomethylamino)-2-[[3-[[3-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoyl]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | Cc1nn(C)c(C)c1CNC(=O)c1cccc(S(=O)(=O)Nc2ccsc2C(=O)N[C@@H](CCCNC(N)N)C(=O)O)c1 |
| InChI | InChI=1S/C25H34N8O6S2/c1-14-18(15(2)33(3)31-14)13-29-22(34)16-6-4-7-17(12-16)41(38,39)32-19-9-11-40-21(19)23(35)30-20(24(36)37)8-5-10-28-25(26)27/h4,6-7,9,11-12,20,25,28,32H,5,8,10,13,26-27H2,1-3H3,(H,29,34)(H,30,35)(H,36,37)/t20-/m0/s1 |
| InChIKey | MFQYZNRGGDHFIP-FQEVSTJZSA-N |
| XLogP | 0.58 |
| TPSA | 223.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|