C22H25N7O6S2 — CID 59159632
(2S)-5-(diaminomethylideneamino)-2-[[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 59159632) has the molecular formula C22H25N7O6S2 and a molecular weight of 547.62 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59159632 |
| Molecular Formula | C22H25N7O6S2 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | COc1ncc(-c2ccc(S(=O)(=O)Nc3ccsc3C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)cc2)cn1 |
| InChI | InChI=1S/C22H25N7O6S2/c1-35-22-26-11-14(12-27-22)13-4-6-15(7-5-13)37(33,34)29-16-8-10-36-18(16)19(30)28-17(20(31)32)3-2-9-25-21(23)24/h4-8,10-12,17,29H,2-3,9H2,1H3,(H,28,30)(H,31,32)(H4,23,24,25)/t17-/m0/s1 |
| InChIKey | OZDXWPPOXVTODS-KRWDZBQOSA-N |
| XLogP | 1.25 |
| TPSA | 211.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|