C24H28N6O5S2 — CID 59159537
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(2-pyridin-3-ylethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 59159537) has the molecular formula C24H28N6O5S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(2-pyridin-3-ylethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(2-pyridin-3-ylethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59159537 |
| Molecular Formula | C24H28N6O5S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-(2-pyridin-3-ylethyl)phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(CCc2cccnc2)c1)C(=O)O |
| InChI | InChI=1S/C24H28N6O5S2/c25-24(26)28-12-3-7-20(23(32)33)29-22(31)21-19(10-13-36-21)30-37(34,35)18-6-1-4-16(14-18)8-9-17-5-2-11-27-15-17/h1-2,4-6,10-11,13-15,20,30H,3,7-9,12H2,(H,29,31)(H,32,33)(H4,25,26,28)/t20-/m0/s1 |
| InChIKey | SRMSLTYAMRQKMM-FQEVSTJZSA-N |
| XLogP | 1.97 |
| TPSA | 189.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|