C29H35N11O5S3 — CID 51001451
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyrazin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 51001451) has the molecular formula C29H35N11O5S3 and a molecular weight of 713.87 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyrazin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyrazin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 51001451 |
| Molecular Formula | C29H35N11O5S3 |
| Molecular Weight | 713.87 g/mol |
| Exact Mass | 713.20 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyrazin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2csc(N3CCN(c4cnccn4)CC3)n2)c1)C(=O)O |
| InChI | InChI=1S/C29H35N11O5S3/c30-28(31)34-7-2-5-23(27(42)43)37-26(41)25-22(6-14-46-25)38-48(44,45)21-4-1-3-19(15-21)35-16-20-18-47-29(36-20)40-12-10-39(11-13-40)24-17-32-8-9-33-24/h1,3-4,6,8-9,14-15,17-18,23,35,38H,2,5,7,10-13,16H2,(H,37,41)(H,42,43)(H4,30,31,34)/t23-/m0/s1 |
| InChIKey | WLDVGPZUSXFKQT-QHCPKHFHSA-N |
| XLogP | 1.97 |
| TPSA | 234.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.87 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|