C31H38N10O5S3 — CID 75599234
5-(diaminomethylideneamino)-2-[[3-[[3-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 75599234) has the molecular formula C31H38N10O5S3 and a molecular weight of 726.91 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[3-[[3-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[3-[[3-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 75599234 |
| Molecular Formula | C31H38N10O5S3 |
| Molecular Weight | 726.91 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[3-[[3-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2csc(N3CCN(Cc4ccccn4)CC3)n2)c1)C(=O)O |
| InChI | InChI=1S/C31H38N10O5S3/c32-30(33)35-11-4-8-26(29(43)44)38-28(42)27-25(9-16-47-27)39-49(45,46)24-7-3-6-21(17-24)36-18-23-20-48-31(37-23)41-14-12-40(13-15-41)19-22-5-1-2-10-34-22/h1-3,5-7,9-10,16-17,20,26,36,39H,4,8,11-15,18-19H2,(H,38,42)(H,43,44)(H4,32,33,35) |
| InChIKey | PLGPAGXFRVHDCI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 221.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.91 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|