C32H38N6O8S2 — CID 70375514
1-[[3-[7-[[2-[[1-carboxy-4-(diaminomethylideneamino)butyl]carbamoyl]thiophen-3-yl]sulfamoyl]-2,3-dihydro-1-benzofuran-5-yl]phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 70375514) has the molecular formula C32H38N6O8S2 and a molecular weight of 698.82 g/mol. Its IUPAC name is 1-[[3-[7-[[2-[[1-carboxy-4-(diaminomethylideneamino)butyl]carbamoyl]thiophen-3-yl]sulfamoyl]-2,3-dihydro-1-benzofuran-5-yl]phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[3-[7-[[2-[[1-carboxy-4-(diaminomethylideneamino)butyl]carbamoyl]thiophen-3-yl]sulfamoyl]-2,3-dihydro-1-benzofuran-5-yl]phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70375514 |
| Molecular Formula | C32H38N6O8S2 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 1-[[3-[7-[[2-[[1-carboxy-4-(diaminomethylideneamino)butyl]carbamoyl]thiophen-3-yl]sulfamoyl]-2,3-dihydro-1-benzofuran-5-yl]phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | NC(N)=NCCCC(NC(=O)c1sccc1NS(=O)(=O)c1cc(-c2cccc(CN3CCC(C(=O)O)CC3)c2)cc2c1OCC2)C(=O)O |
| InChI | InChI=1S/C32H38N6O8S2/c33-32(34)35-10-2-5-25(31(42)43)36-29(39)28-24(9-14-47-28)37-48(44,45)26-17-23(16-22-8-13-46-27(22)26)21-4-1-3-19(15-21)18-38-11-6-20(7-12-38)30(40)41/h1,3-4,9,14-17,20,25,37H,2,5-8,10-13,18H2,(H,36,39)(H,40,41)(H,42,43)(H4,33,34,35) |
| InChIKey | DRRGUOSBIQPAIQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 226.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|