C34H42N6O7S2 — CID 70375543
5-(diaminomethylideneamino)-2-[[3-[[5-[2-[[4-(2-oxopropyl)piperidin-1-yl]methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 70375543) has the molecular formula C34H42N6O7S2 and a molecular weight of 710.88 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[3-[[5-[2-[[4-(2-oxopropyl)piperidin-1-yl]methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[3-[[5-[2-[[4-(2-oxopropyl)piperidin-1-yl]methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70375543 |
| Molecular Formula | C34H42N6O7S2 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.26 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[3-[[5-[2-[[4-(2-oxopropyl)piperidin-1-yl]methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | CC(=O)CC1CCN(Cc2ccccc2-c2cc3c(c(S(=O)(=O)Nc4ccsc4C(=O)NC(CCCN=C(N)N)C(=O)O)c2)OCC3)CC1 |
| InChI | InChI=1S/C34H42N6O7S2/c1-21(41)17-22-8-13-40(14-9-22)20-24-5-2-3-6-26(24)25-18-23-10-15-47-30(23)29(19-25)49(45,46)39-27-11-16-48-31(27)32(42)38-28(33(43)44)7-4-12-37-34(35)36/h2-3,5-6,11,16,18-19,22,28,39H,4,7-10,12-15,17,20H2,1H3,(H,38,42)(H,43,44)(H4,35,36,37) |
| InChIKey | WBOPLUWEWUYUBC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 206.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|