C21H23N7O5S2 — CID 59159617
(2S)-5-(diaminomethylideneamino)-2-[[3-[(2-pyrimidin-5-ylphenyl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 59159617) has the molecular formula C21H23N7O5S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[(2-pyrimidin-5-ylphenyl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[(2-pyrimidin-5-ylphenyl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59159617 |
| Molecular Formula | C21H23N7O5S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[(2-pyrimidin-5-ylphenyl)sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1ccccc1-c1cncnc1)C(=O)O |
| InChI | InChI=1S/C21H23N7O5S2/c22-21(23)26-8-3-5-16(20(30)31)27-19(29)18-15(7-9-34-18)28-35(32,33)17-6-2-1-4-14(17)13-10-24-12-25-11-13/h1-2,4,6-7,9-12,16,28H,3,5,8H2,(H,27,29)(H,30,31)(H4,22,23,26)/t16-/m0/s1 |
| InChIKey | PIOCJCFIPLBYMU-INIZCTEOSA-N |
| XLogP | 1.24 |
| TPSA | 202.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|