C30H34N8O6S2 — CID 51000712
(2S)-5-(diaminomethylideneamino)-2-[[3-[[5-[3-[(1H-imidazol-5-ylmethylamino)methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 51000712) has the molecular formula C30H34N8O6S2 and a molecular weight of 666.79 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[5-[3-[(1H-imidazol-5-ylmethylamino)methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[5-[3-[(1H-imidazol-5-ylmethylamino)methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 51000712 |
| Molecular Formula | C30H34N8O6S2 |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[5-[3-[(1H-imidazol-5-ylmethylamino)methyl]phenyl]-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cc(-c2cccc(CNCc3cnc[nH]3)c2)cc2c1OCC2)C(=O)O |
| InChI | InChI=1S/C30H34N8O6S2/c31-30(32)35-8-2-5-24(29(40)41)37-28(39)27-23(7-10-45-27)38-46(42,43)25-13-21(12-20-6-9-44-26(20)25)19-4-1-3-18(11-19)14-33-15-22-16-34-17-36-22/h1,3-4,7,10-13,16-17,24,33,38H,2,5-6,8-9,14-15H2,(H,34,36)(H,37,39)(H,40,41)(H4,31,32,35)/t24-/m0/s1 |
| InChIKey | QTUYCAMEJLFWKS-DEOSSOPVSA-N |
| XLogP | 2.40 |
| TPSA | 226.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|