C23H29N7O6S2 — CID 69098361
(2S)-5-(diaminomethylamino)-2-[[3-[[5-(1-methylpyrazol-4-yl)-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 69098361) has the molecular formula C23H29N7O6S2 and a molecular weight of 563.66 g/mol. Its IUPAC name is (2S)-5-(diaminomethylamino)-2-[[3-[[5-(1-methylpyrazol-4-yl)-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylamino)-2-[[3-[[5-(1-methylpyrazol-4-yl)-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69098361 |
| Molecular Formula | C23H29N7O6S2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | (2S)-5-(diaminomethylamino)-2-[[3-[[5-(1-methylpyrazol-4-yl)-2,3-dihydro-1-benzofuran-7-yl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | Cn1cc(-c2cc3c(c(S(=O)(=O)Nc4ccsc4C(=O)N[C@@H](CCCNC(N)N)C(=O)O)c2)OCC3)cn1 |
| InChI | InChI=1S/C23H29N7O6S2/c1-30-12-15(11-27-30)14-9-13-4-7-36-19(13)18(10-14)38(34,35)29-16-5-8-37-20(16)21(31)28-17(22(32)33)3-2-6-26-23(24)25/h5,8-12,17,23,26,29H,2-4,6-7,24-25H2,1H3,(H,28,31)(H,32,33)/t17-/m0/s1 |
| InChIKey | CTQJQBLLBZPJGU-KRWDZBQOSA-N |
| XLogP | 0.64 |
| TPSA | 203.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|