C23H31ClN8O5S2 — CID 69098318
(2S)-2-[[3-[[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid (PubChem CID 69098318) has the molecular formula C23H31ClN8O5S2 and a molecular weight of 599.14 g/mol. Its IUPAC name is (2S)-2-[[3-[[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid.
| Compound Name | (2S)-2-[[3-[[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid |
|---|---|
| PubChem CID | 69098318 |
| Molecular Formula | C23H31ClN8O5S2 |
| Molecular Weight | 599.14 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | (2S)-2-[[3-[[3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylamino)pentanoic acid |
| SMILES | Cc1nn(C)c(Cl)c1CNc1cccc(S(=O)(=O)Nc2ccsc2C(=O)N[C@@H](CCCNC(N)N)C(=O)O)c1 |
| InChI | InChI=1S/C23H31ClN8O5S2/c1-13-16(20(24)32(2)30-13)12-28-14-5-3-6-15(11-14)39(36,37)31-17-8-10-38-19(17)21(33)29-18(22(34)35)7-4-9-27-23(25)26/h3,5-6,8,10-11,18,23,27-28,31H,4,7,9,12,25-26H2,1-2H3,(H,29,33)(H,34,35)/t18-/m0/s1 |
| InChIKey | HCFVFNAZRAVMOI-SFHVURJKSA-N |
| XLogP | 1.61 |
| TPSA | 206.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|