C17H22BN5O7S2 — CID 70309421
(2S)-2-[[3-[(3-boronophenyl)sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 70309421) has the molecular formula C17H22BN5O7S2 and a molecular weight of 483.34 g/mol. Its IUPAC name is (2S)-2-[[3-[(3-boronophenyl)sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[3-[(3-boronophenyl)sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 70309421 |
| Molecular Formula | C17H22BN5O7S2 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (2S)-2-[[3-[(3-boronophenyl)sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(B(O)O)c1)C(=O)O |
| InChI | InChI=1S/C17H22BN5O7S2/c19-17(20)21-7-2-5-13(16(25)26)22-15(24)14-12(6-8-31-14)23-32(29,30)11-4-1-3-10(9-11)18(27)28/h1,3-4,6,8-9,13,23,27-28H,2,5,7H2,(H,22,24)(H,25,26)(H4,19,20,21)/t13-/m0/s1 |
| InChIKey | OXTSRLFASZRLPX-ZDUSSCGKSA-N |
| XLogP | -1.53 |
| TPSA | 217.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|