C21H24N4O3S — CID 134034024
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(ethylsulfamoyl)benzamide (PubChem CID 134034024) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(ethylsulfamoyl)benzamide.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(ethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 134034024 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(ethylsulfamoyl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)NCc2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-4-23-29(27,28)19-12-8-9-17(13-19)21(26)22-14-20-15(2)24-25(16(20)3)18-10-6-5-7-11-18/h5-13,23H,4,14H2,1-3H3,(H,22,26) |
| InChIKey | QUMXNCUBUKZCAJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |