C22H25ClN4O4S — CID 39969897
2-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-5-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 39969897) has the molecular formula C22H25ClN4O4S and a molecular weight of 476.99 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-5-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-5-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 39969897 |
| Molecular Formula | C22H25ClN4O4S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-5-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Cl)c(C(=O)NCc2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C22H25ClN4O4S/c1-15-20(16(2)27(26-15)17-7-5-4-6-8-17)14-24-22(28)19-13-18(9-10-21(19)23)32(29,30)25-11-12-31-3/h4-10,13,25H,11-12,14H2,1-3H3,(H,24,28) |
| InChIKey | IYGCYCSRIXKBEV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|