C20H23ClN4O4S — CID 31789852
2-chloro-5-(2-methoxyethylsulfamoyl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide (PubChem CID 31789852) has the molecular formula C20H23ClN4O4S and a molecular weight of 450.95 g/mol. Its IUPAC name is 2-chloro-5-(2-methoxyethylsulfamoyl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide.
| Compound Name | 2-chloro-5-(2-methoxyethylsulfamoyl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 31789852 |
| Molecular Formula | C20H23ClN4O4S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2-chloro-5-(2-methoxyethylsulfamoyl)-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Cl)c(C(=O)NCCn2c(C)nc3ccccc32)c1 |
| InChI | InChI=1S/C20H23ClN4O4S/c1-14-24-18-5-3-4-6-19(18)25(14)11-9-22-20(26)16-13-15(7-8-17(16)21)30(27,28)23-10-12-29-2/h3-8,13,23H,9-12H2,1-2H3,(H,22,26) |
| InChIKey | AHYDFBICIPLNNG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|