C19H22N4O3S — CID 35800173
2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-5-(methylsulfamoyl)benzamide (PubChem CID 35800173) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 35800173 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(C(=O)NCCn2c(C)nc3ccccc32)c1 |
| InChI | InChI=1S/C19H22N4O3S/c1-13-8-9-15(27(25,26)20-3)12-16(13)19(24)21-10-11-23-14(2)22-17-6-4-5-7-18(17)23/h4-9,12,20H,10-11H2,1-3H3,(H,21,24) |
| InChIKey | BEUHBDZBDJQESA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |