C19H19FN4O2 — CID 17395811
2-fluoro-N-[2-[2-(2-methylbenzimidazol-1-yl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 17395811) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-fluoro-N-[2-[2-(2-methylbenzimidazol-1-yl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[2-(2-methylbenzimidazol-1-yl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17395811 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-fluoro-N-[2-[2-(2-methylbenzimidazol-1-yl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C19H19FN4O2/c1-13-23-16-8-4-5-9-17(16)24(13)11-10-21-18(25)12-22-19(26)14-6-2-3-7-15(14)20/h2-9H,10-12H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | WZVPJSXQKRBRAJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |