C21H17FN4O — CID 53063086
2-fluoro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzamide (PubChem CID 53063086) has the molecular formula C21H17FN4O and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 53063086 |
| Molecular Formula | C21H17FN4O |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-fluoro-N-[2-(2-pyridin-4-ylbenzimidazol-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1c(-c2ccncc2)nc2ccccc21)c1ccccc1F |
| InChI | InChI=1S/C21H17FN4O/c22-17-6-2-1-5-16(17)21(27)24-13-14-26-19-8-4-3-7-18(19)25-20(26)15-9-11-23-12-10-15/h1-12H,13-14H2,(H,24,27) |
| InChIKey | QMEPBLHYFRKQTE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |