C22H28N4O3S — CID 26444084
5-(diethylsulfamoyl)-2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide (PubChem CID 26444084) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 26444084 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)NCCn2c(C)nc3ccccc32)c1 |
| InChI | InChI=1S/C22H28N4O3S/c1-5-25(6-2)30(28,29)18-12-11-16(3)19(15-18)22(27)23-13-14-26-17(4)24-20-9-7-8-10-21(20)26/h7-12,15H,5-6,13-14H2,1-4H3,(H,23,27) |
| InChIKey | JFMIQTFBIHKOPA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |