C22H28N4O4S — CID 25333479
methyl 5-(diethylsulfamoyl)-2-[2-(2-methylbenzimidazol-1-yl)ethylamino]benzoate (PubChem CID 25333479) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is methyl 5-(diethylsulfamoyl)-2-[2-(2-methylbenzimidazol-1-yl)ethylamino]benzoate.
| Compound Name | methyl 5-(diethylsulfamoyl)-2-[2-(2-methylbenzimidazol-1-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 25333479 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | methyl 5-(diethylsulfamoyl)-2-[2-(2-methylbenzimidazol-1-yl)ethylamino]benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCCn2c(C)nc3ccccc32)c(C(=O)OC)c1 |
| InChI | InChI=1S/C22H28N4O4S/c1-5-25(6-2)31(28,29)17-11-12-19(18(15-17)22(27)30-4)23-13-14-26-16(3)24-20-9-7-8-10-21(20)26/h7-12,15,23H,5-6,13-14H2,1-4H3 |
| InChIKey | JJBJPYPRWPBVDO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |