C17H17ClN4O2S — CID 9191231
6-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyridine-3-sulfonamide (PubChem CID 9191231) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 6-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 9191231 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 6-chloro-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CNS(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H17ClN4O2S/c1-12-16(13(2)22(21-12)14-6-4-3-5-7-14)11-20-25(23,24)15-8-9-17(18)19-10-15/h3-10,20H,11H2,1-2H3 |
| InChIKey | HJGBODHVPFFMGC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|