C9H9BrN2O5 — CID 30118248
(2R)-4-amino-2-[(5-bromofuran-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 30118248) has the molecular formula C9H9BrN2O5 and a molecular weight of 305.08 g/mol. Its IUPAC name is (2R)-4-amino-2-[(5-bromofuran-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(5-bromofuran-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 30118248 |
| Molecular Formula | C9H9BrN2O5 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | (2R)-4-amino-2-[(5-bromofuran-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)c1ccc(Br)o1)C(=O)O |
| InChI | InChI=1S/C9H9BrN2O5/c10-6-2-1-5(17-6)8(14)12-4(9(15)16)3-7(11)13/h1-2,4H,3H2,(H2,11,13)(H,12,14)(H,15,16)/t4-/m1/s1 |
| InChIKey | OXIJOHUDYBKWIG-SCSAIBSYSA-N |
| XLogP | 0.10 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |