C10H12N2O5 — CID 28778450
(2R)-4-amino-2-[(5-methylfuran-2-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 28778450) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is (2R)-4-amino-2-[(5-methylfuran-2-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(5-methylfuran-2-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 28778450 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (2R)-4-amino-2-[(5-methylfuran-2-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(C(=O)N[C@H](CC(N)=O)C(=O)O)o1 |
| InChI | InChI=1S/C10H12N2O5/c1-5-2-3-7(17-5)9(14)12-6(10(15)16)4-8(11)13/h2-3,6H,4H2,1H3,(H2,11,13)(H,12,14)(H,15,16)/t6-/m1/s1 |
| InChIKey | SLNXELVXPQJIPE-ZCFIWIBFSA-N |
| XLogP | -0.35 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |