C14H18ClNO3 — CID 18391315
propan-2-yl N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 18391315) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18391315 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | propan-2-yl N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)CCl |
| InChI | InChI=1S/C14H18ClNO3/c1-10(2)19-14(18)16-12(13(17)9-15)8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | ZZOLFRSXOXKLKL-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|