C17H26NO2P — CID 130251446
tert-butyl 1-benzyl-1,4-azaphosphepane-5-carboxylate (PubChem CID 130251446) has the molecular formula C17H26NO2P and a molecular weight of 307.37 g/mol. Its IUPAC name is tert-butyl 1-benzyl-1,4-azaphosphepane-5-carboxylate.
| Compound Name | tert-butyl 1-benzyl-1,4-azaphosphepane-5-carboxylate |
|---|---|
| PubChem CID | 130251446 |
| Molecular Formula | C17H26NO2P |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | tert-butyl 1-benzyl-1,4-azaphosphepane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCN(Cc2ccccc2)CCP1 |
| InChI | InChI=1S/C17H26NO2P/c1-17(2,3)20-16(19)15-9-10-18(11-12-21-15)13-14-7-5-4-6-8-14/h4-8,15,21H,9-13H2,1-3H3 |
| InChIKey | HXHMRHLHBPNDBR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|