C18H30N2O2Si — CID 58721822
3-amino-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,4-dihydroquinolin-2-one (PubChem CID 58721822) has the molecular formula C18H30N2O2Si and a molecular weight of 334.54 g/mol. Its IUPAC name is 3-amino-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 3-amino-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 58721822 |
| Molecular Formula | C18H30N2O2Si |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-amino-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,4-dihydroquinolin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCN1C(=O)C(N)Cc2ccccc21 |
| InChI | InChI=1S/C18H30N2O2Si/c1-18(2,3)23(4,5)22-12-8-11-20-16-10-7-6-9-14(16)13-15(19)17(20)21/h6-7,9-10,15H,8,11-13,19H2,1-5H3 |
| InChIKey | DKCNQWDJEQMERX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|