C20H19N3O5 — CID 51319036
6-nitro-4-[2-oxo-2-(2-phenylpyrrolidin-1-yl)ethyl]-1,4-benzoxazin-3-one (PubChem CID 51319036) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 6-nitro-4-[2-oxo-2-(2-phenylpyrrolidin-1-yl)ethyl]-1,4-benzoxazin-3-one.
| Compound Name | 6-nitro-4-[2-oxo-2-(2-phenylpyrrolidin-1-yl)ethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 51319036 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 6-nitro-4-[2-oxo-2-(2-phenylpyrrolidin-1-yl)ethyl]-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc([N+](=O)[O-])cc2N1CC(=O)N1CCCC1c1ccccc1 |
| InChI | InChI=1S/C20H19N3O5/c24-19(21-10-4-7-16(21)14-5-2-1-3-6-14)12-22-17-11-15(23(26)27)8-9-18(17)28-13-20(22)25/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2 |
| InChIKey | MKMINQUYZWEMKR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|