About 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one
4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one (PubChem CID 39996182) has the molecular formula C17H21N3O6
and a molecular weight of 363.37 g/mol. Its IUPAC name is 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one |
| PubChem CID | 39996182 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one |
| SMILES | CC[C@H]1CO[C@@H](C)CN1C(=O)CN1C(=O)COc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H21N3O6/c1-3-12-9-25-11(2)7-18(12)16(21)8-19-14-6-13(20(23)24)4-5-15(14)26-10-17(19)22/h4-6,11-12H,3,7-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | RPTKVGMDZKVWFR-RYUDHWBXSA-N |
| XLogP | 1.35 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one?
The IUPAC name of 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one (CID 39996182) is 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one?
The canonical SMILES for 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one is CC[C@H]1CO[C@@H](C)CN1C(=O)CN1C(=O)COc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one?
The InChIKey is RPTKVGMDZKVWFR-RYUDHWBXSA-N. The full InChI is InChI=1S/C17H21N3O6/c1-3-12-9-25-11(2)7-18(12)16(21)8-19-14-6-13(20(23)24)4-5-15(14)26-10-17(19)22/h4-6,11-12H,3,7-10H2,1-2H3/t11-,12-/m0/s1.
What are the key properties of 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one?
4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one has a molecular weight of 363.37 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2S,5S)-5-ethyl-2-methylmorpholin-4-yl]-2-oxoethyl]-6-nitro-1,4-benzoxazin-3-one is sourced from PubChem (CID 39996182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).