C17H22N6O4S — CID 55951627
1-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 55951627) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55951627 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | Cc1csc(NC(=O)C2CCN(C(=O)Cn3nc(C)c([N+](=O)[O-])c3C)CC2)n1 |
| InChI | InChI=1S/C17H22N6O4S/c1-10-9-28-17(18-10)19-16(25)13-4-6-21(7-5-13)14(24)8-22-12(3)15(23(26)27)11(2)20-22/h9,13H,4-8H2,1-3H3,(H,18,19,25) |
| InChIKey | ZNBFLACVCWMOAA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|