C18H23N3O7S — CID 55507950
N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 55507950) has the molecular formula C18H23N3O7S and a molecular weight of 425.46 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 55507950 |
| Molecular Formula | C18H23N3O7S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | CCCCN(C(=O)CN1C(=O)COc2ccc([N+](=O)[O-])cc21)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H23N3O7S/c1-2-3-7-19(14-6-8-29(26,27)12-14)17(22)10-20-15-9-13(21(24)25)4-5-16(15)28-11-18(20)23/h4-5,9,14H,2-3,6-8,10-12H2,1H3 |
| InChIKey | KEHYROPNMWMCLI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|