C24H23N5O6 — CID 136606187
(Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 136606187) has the molecular formula C24H23N5O6 and a molecular weight of 477.48 g/mol. Its IUPAC name is (Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 136606187 |
| Molecular Formula | C24H23N5O6 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (Z)-N-[3-(furan-2-yl)-1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-5-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C\C(=O)Nc2cc(-c3ccco3)nn2-c2nc(C)cc(=O)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23N5O6/c1-14-10-22(31)27-24(25-14)29-20(13-16(28-29)17-6-5-9-35-17)26-21(30)8-7-15-11-18(32-2)23(34-4)19(12-15)33-3/h5-13H,1-4H3,(H,26,30)(H,25,27,31)/b8-7- |
| InChIKey | KGUIOFANFFSITK-FPLPWBNLSA-N |
| XLogP | 3.20 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|