C19H28N6O4 — CID 136641368
N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 136641368) has the molecular formula C19H28N6O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 136641368 |
| Molecular Formula | C19H28N6O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N'-[2-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | CCc1c(C)nc(-n2nc(C)cc2NC(=O)C(=O)NCCCOC(C)C)[nH]c1=O |
| InChI | InChI=1S/C19H28N6O4/c1-6-14-13(5)21-19(23-16(14)26)25-15(10-12(4)24-25)22-18(28)17(27)20-8-7-9-29-11(2)3/h10-11H,6-9H2,1-5H3,(H,20,27)(H,22,28)(H,21,23,26) |
| InChIKey | FGNMQMZTLLGONP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|