C21H25N5O4 — CID 42649876
N'-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-N-(3-imidazol-1-ylpropyl)oxamide (PubChem CID 42649876) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N'-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-N-(3-imidazol-1-ylpropyl)oxamide.
| Compound Name | N'-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-N-(3-imidazol-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 42649876 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N'-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-N-(3-imidazol-1-ylpropyl)oxamide |
| SMILES | CCC1(c2ccc(NC(=O)C(=O)NCCCn3ccnc3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C21H25N5O4/c1-2-21(9-8-17(27)25-20(21)30)15-4-6-16(7-5-15)24-19(29)18(28)23-10-3-12-26-13-11-22-14-26/h4-7,11,13-14H,2-3,8-10,12H2,1H3,(H,23,28)(H,24,29)(H,25,27,30) |
| InChIKey | UXDXHNAVADPPSX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|