C20H19Cl2N3O3 — CID 4049256
1-(3,4-dichlorophenyl)-3-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]urea (PubChem CID 4049256) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 4049256 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]urea |
| SMILES | CCC1(c2ccc(NC(=O)Nc3ccc(Cl)c(Cl)c3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-2-20(10-9-17(26)25-18(20)27)12-3-5-13(6-4-12)23-19(28)24-14-7-8-15(21)16(22)11-14/h3-8,11H,2,9-10H2,1H3,(H2,23,24,28)(H,25,26,27) |
| InChIKey | MQPALEZAIOPFTL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|