C18H20N2O3 — CID 167747058
N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide (PubChem CID 167747058) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide.
| Compound Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
|---|---|
| PubChem CID | 167747058 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
| SMILES | CCC1(c2ccc(NC(=O)C34CC3C4)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C18H20N2O3/c1-2-17(8-7-14(21)20-15(17)22)11-3-5-13(6-4-11)19-16(23)18-9-12(18)10-18/h3-6,12H,2,7-10H2,1H3,(H,19,23)(H,20,21,22) |
| InChIKey | RVICZRJXIGKNFZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|