C22H24N2O3 — CID 94533339
N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-3,4-dimethylbenzamide (PubChem CID 94533339) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 94533339 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-3,4-dimethylbenzamide |
| SMILES | CC[C@@]1(c2ccc(NC(=O)c3ccc(C)c(C)c3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C22H24N2O3/c1-4-22(12-11-19(25)24-21(22)27)17-7-9-18(10-8-17)23-20(26)16-6-5-14(2)15(3)13-16/h5-10,13H,4,11-12H2,1-3H3,(H,23,26)(H,24,25,27)/t22-/m0/s1 |
| InChIKey | PXNFLKGNVYMNGD-QFIPXVFZSA-N |
| XLogP | 3.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|