C22H19ClN2O4 — CID 41062159
5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 41062159) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is 5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 41062159 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | CC[C@@]1(c2ccc(NC(=O)c3cc4cc(Cl)ccc4o3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C22H19ClN2O4/c1-2-22(10-9-19(26)25-21(22)28)14-3-6-16(7-4-14)24-20(27)18-12-13-11-15(23)5-8-17(13)29-18/h3-8,11-12H,2,9-10H2,1H3,(H,24,27)(H,25,26,28)/t22-/m0/s1 |
| InChIKey | ZZSMDPZGOQYHOF-QFIPXVFZSA-N |
| XLogP | 4.42 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|