C17H16BrN3O3S — CID 86807048
5-bromo-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3-thiazole-2-carboxamide (PubChem CID 86807048) has the molecular formula C17H16BrN3O3S and a molecular weight of 422.30 g/mol. Its IUPAC name is 5-bromo-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | 5-bromo-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 86807048 |
| Molecular Formula | C17H16BrN3O3S |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 5-bromo-N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-1,3-thiazole-2-carboxamide |
| SMILES | CCC1(c2ccc(NC(=O)c3ncc(Br)s3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C17H16BrN3O3S/c1-2-17(8-7-13(22)21-16(17)24)10-3-5-11(6-4-10)20-14(23)15-19-9-12(18)25-15/h3-6,9H,2,7-8H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | MHBQCAUHSFZCEC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|